C24H22F2N4 — CID 121453142
N-[2-[(E)-2-(3,4-difluorophenyl)ethenyl]benzo[g]quinazolin-4-yl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 121453142) has the molecular formula C24H22F2N4 and a molecular weight of 404.46 g/mol. Its IUPAC name is N-[2-[(E)-2-(3,4-difluorophenyl)ethenyl]benzo[g]quinazolin-4-yl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[2-[(E)-2-(3,4-difluorophenyl)ethenyl]benzo[g]quinazolin-4-yl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 121453142 |
| Molecular Formula | C24H22F2N4 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | N-[2-[(E)-2-(3,4-difluorophenyl)ethenyl]benzo[g]quinazolin-4-yl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | CN(C)CCNc1nc(/C=C/c2ccc(F)c(F)c2)nc2cc3ccccc3cc12 |
| InChI | InChI=1S/C24H22F2N4/c1-30(2)12-11-27-24-19-14-17-5-3-4-6-18(17)15-22(19)28-23(29-24)10-8-16-7-9-20(25)21(26)13-16/h3-10,13-15H,11-12H2,1-2H3,(H,27,28,29)/b10-8+ |
| InChIKey | ZBDKWWURYKMJJC-CSKARUKUSA-N |
| XLogP | 5.21 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|