C26H33ClN4 — CID 121453157
N-[6-chloro-2-[(E)-2-(4-propan-2-ylphenyl)ethenyl]quinazolin-4-yl]-N',N'-diethylpropane-1,3-diamine (PubChem CID 121453157) has the molecular formula C26H33ClN4 and a molecular weight of 437.03 g/mol. Its IUPAC name is N-[6-chloro-2-[(E)-2-(4-propan-2-ylphenyl)ethenyl]quinazolin-4-yl]-N',N'-diethylpropane-1,3-diamine.
| Compound Name | N-[6-chloro-2-[(E)-2-(4-propan-2-ylphenyl)ethenyl]quinazolin-4-yl]-N',N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 121453157 |
| Molecular Formula | C26H33ClN4 |
| Molecular Weight | 437.03 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | N-[6-chloro-2-[(E)-2-(4-propan-2-ylphenyl)ethenyl]quinazolin-4-yl]-N',N'-diethylpropane-1,3-diamine |
| SMILES | CCN(CC)CCCNc1nc(/C=C/c2ccc(C(C)C)cc2)nc2ccc(Cl)cc12 |
| InChI | InChI=1S/C26H33ClN4/c1-5-31(6-2)17-7-16-28-26-23-18-22(27)13-14-24(23)29-25(30-26)15-10-20-8-11-21(12-9-20)19(3)4/h8-15,18-19H,5-7,16-17H2,1-4H3,(H,28,29,30)/b15-10+ |
| InChIKey | FSQXNAHEBFNFAZ-XNTDXEJSSA-N |
| XLogP | 6.72 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.03 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|