C19H17F6N7O — CID 121453832
1,1,1,3,3,3-hexadeuterio-2-[[[4-[6-(trifluoromethyl)-2-pyridinyl]-6-[[2-(trifluoromethyl)-4-pyridinyl]amino]-1,3,5-triazin-2-yl]amino]methyl]propan-2-ol (PubChem CID 121453832) has the molecular formula C19H17F6N7O and a molecular weight of 479.42 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexadeuterio-2-[[[4-[6-(trifluoromethyl)-2-pyridinyl]-6-[[2-(trifluoromethyl)-4-pyridinyl]amino]-1,3,5-triazin-2-yl]amino]methyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexadeuterio-2-[[[4-[6-(trifluoromethyl)-2-pyridinyl]-6-[[2-(trifluoromethyl)-4-pyridinyl]amino]-1,3,5-triazin-2-yl]amino]methyl]propan-2-ol |
|---|---|
| PubChem CID | 121453832 |
| Molecular Formula | C19H17F6N7O |
| Molecular Weight | 479.42 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | 1,1,1,3,3,3-hexadeuterio-2-[[[4-[6-(trifluoromethyl)-2-pyridinyl]-6-[[2-(trifluoromethyl)-4-pyridinyl]amino]-1,3,5-triazin-2-yl]amino]methyl]propan-2-ol |
| SMILES | [2H]C([2H])([2H])C(O)(CNc1nc(Nc2ccnc(C(F)(F)F)c2)nc(-c2cccc(C(F)(F)F)n2)n1)C([2H])([2H])[2H] |
| InChI | InChI=1S/C19H17F6N7O/c1-17(2,33)9-27-15-30-14(11-4-3-5-12(29-11)18(20,21)22)31-16(32-15)28-10-6-7-26-13(8-10)19(23,24)25/h3-8,33H,9H2,1-2H3,(H2,26,27,28,30,31,32)/i1D3,2D3 |
| InChIKey | DYLUUSLLRIQKOE-WFGJKAKNSA-N |
| XLogP | 4.29 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.42 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |