C26H28N2O3 — CID 121454841
(2S)-2-amino-3-[4-[2-(4-phenylphenyl)butylcarbamoyl]phenyl]propanoic acid (PubChem CID 121454841) has the molecular formula C26H28N2O3 and a molecular weight of 416.52 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-[2-(4-phenylphenyl)butylcarbamoyl]phenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[4-[2-(4-phenylphenyl)butylcarbamoyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 121454841 |
| Molecular Formula | C26H28N2O3 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | (2S)-2-amino-3-[4-[2-(4-phenylphenyl)butylcarbamoyl]phenyl]propanoic acid |
| SMILES | CCC(CNC(=O)c1ccc(C[C@H](N)C(=O)O)cc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H28N2O3/c1-2-19(21-12-14-22(15-13-21)20-6-4-3-5-7-20)17-28-25(29)23-10-8-18(9-11-23)16-24(27)26(30)31/h3-15,19,24H,2,16-17,27H2,1H3,(H,28,29)(H,30,31)/t19?,24-/m0/s1 |
| InChIKey | IVUXJJLQQYWWPX-WIIYFNMSSA-N |
| XLogP | 4.23 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |