About methyl 5-(8-chloroimidazo[1,5-a]pyrazin-3-yl)-2-propan-2-ylcyclohexane-1-carboxylate
methyl 5-(8-chloroimidazo[1,5-a]pyrazin-3-yl)-2-propan-2-ylcyclohexane-1-carboxylate (PubChem CID 121454971) has the molecular formula C17H22ClN3O2
and a molecular weight of 335.84 g/mol. Its IUPAC name is methyl 5-(8-chloroimidazo[1,5-a]pyrazin-3-yl)-2-propan-2-ylcyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | methyl 5-(8-chloroimidazo[1,5-a]pyrazin-3-yl)-2-propan-2-ylcyclohexane-1-carboxylate |
| PubChem CID | 121454971 |
| Molecular Formula | C17H22ClN3O2 |
| Molecular Weight | 335.84 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | methyl 5-(8-chloroimidazo[1,5-a]pyrazin-3-yl)-2-propan-2-ylcyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CC(c2ncc3c(Cl)nccn23)CCC1C(C)C |
| InChI | InChI=1S/C17H22ClN3O2/c1-10(2)12-5-4-11(8-13(12)17(22)23-3)16-20-9-14-15(18)19-6-7-21(14)16/h6-7,9-13H,4-5,8H2,1-3H3 |
| InChIKey | CTPLLOKOWZQTAX-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.84 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 5-(8-chloroimidazo[1,5-a]pyrazin-3-yl)-2-propan-2-ylcyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-(8-chloroimidazo[1,5-a]pyrazin-3-yl)-2-propan-2-ylcyclohexane-1-carboxylate?
The IUPAC name of methyl 5-(8-chloroimidazo[1,5-a]pyrazin-3-yl)-2-propan-2-ylcyclohexane-1-carboxylate (CID 121454971) is methyl 5-(8-chloroimidazo[1,5-a]pyrazin-3-yl)-2-propan-2-ylcyclohexane-1-carboxylate.
What is the SMILES notation for methyl 5-(8-chloroimidazo[1,5-a]pyrazin-3-yl)-2-propan-2-ylcyclohexane-1-carboxylate?
The canonical SMILES for methyl 5-(8-chloroimidazo[1,5-a]pyrazin-3-yl)-2-propan-2-ylcyclohexane-1-carboxylate is COC(=O)C1CC(c2ncc3c(Cl)nccn23)CCC1C(C)C.
What is the InChIKey of methyl 5-(8-chloroimidazo[1,5-a]pyrazin-3-yl)-2-propan-2-ylcyclohexane-1-carboxylate?
The InChIKey is CTPLLOKOWZQTAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22ClN3O2/c1-10(2)12-5-4-11(8-13(12)17(22)23-3)16-20-9-14-15(18)19-6-7-21(14)16/h6-7,9-13H,4-5,8H2,1-3H3.
What are the key properties of methyl 5-(8-chloroimidazo[1,5-a]pyrazin-3-yl)-2-propan-2-ylcyclohexane-1-carboxylate?
methyl 5-(8-chloroimidazo[1,5-a]pyrazin-3-yl)-2-propan-2-ylcyclohexane-1-carboxylate has a molecular weight of 335.84 g/mol, XLogP of 3.71, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(8-chloroimidazo[1,5-a]pyrazin-3-yl)-2-propan-2-ylcyclohexane-1-carboxylate is sourced from PubChem (CID 121454971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).