C16H12Cl2N6 — CID 121455904
6-(4,6-dichloro-2-pyridinyl)-2-pyrimidin-2-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine (PubChem CID 121455904) has the molecular formula C16H12Cl2N6 and a molecular weight of 359.22 g/mol. Its IUPAC name is 6-(4,6-dichloro-2-pyridinyl)-2-pyrimidin-2-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine.
| Compound Name | 6-(4,6-dichloro-2-pyridinyl)-2-pyrimidin-2-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 121455904 |
| Molecular Formula | C16H12Cl2N6 |
| Molecular Weight | 359.22 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | 6-(4,6-dichloro-2-pyridinyl)-2-pyrimidin-2-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
| SMILES | Clc1cc(Cl)nc(N2CCc3nc(-c4ncccn4)ncc3C2)c1 |
| InChI | InChI=1S/C16H12Cl2N6/c17-11-6-13(18)23-14(7-11)24-5-2-12-10(9-24)8-21-16(22-12)15-19-3-1-4-20-15/h1,3-4,6-8H,2,5,9H2 |
| InChIKey | TYFJFGRABRHGHL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 67.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.22 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|