C22H22F2N4O2 — CID 121455965
6-[3,4-difluoro-5-(3-methoxypropoxy)phenyl]-2-pyridin-2-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine (PubChem CID 121455965) has the molecular formula C22H22F2N4O2 and a molecular weight of 412.44 g/mol. Its IUPAC name is 6-[3,4-difluoro-5-(3-methoxypropoxy)phenyl]-2-pyridin-2-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine.
| Compound Name | 6-[3,4-difluoro-5-(3-methoxypropoxy)phenyl]-2-pyridin-2-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 121455965 |
| Molecular Formula | C22H22F2N4O2 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 6-[3,4-difluoro-5-(3-methoxypropoxy)phenyl]-2-pyridin-2-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
| SMILES | COCCCOc1cc(N2CCc3nc(-c4ccccn4)ncc3C2)cc(F)c1F |
| InChI | InChI=1S/C22H22F2N4O2/c1-29-9-4-10-30-20-12-16(11-17(23)21(20)24)28-8-6-18-15(14-28)13-26-22(27-18)19-5-2-3-7-25-19/h2-3,5,7,11-13H,4,6,8-10,14H2,1H3 |
| InChIKey | XUFLAFNAKKJMJD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|