About 4-azatricyclo[6.2.1.01,6]undeca-2,4,7,9-tetraene
4-azatricyclo[6.2.1.01,6]undeca-2,4,7,9-tetraene (PubChem CID 121456152) has the molecular formula C10H9N
and a molecular weight of 143.19 g/mol. Its IUPAC name is 4-azatricyclo[6.2.1.01,6]undeca-2,4,7,9-tetraene.
Analyze 4-azatricyclo[6.2.1.01,6]undeca-2,4,7,9-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-azatricyclo[6.2.1.01,6]undeca-2,4,7,9-tetraene?
The IUPAC name of 4-azatricyclo[6.2.1.01,6]undeca-2,4,7,9-tetraene (CID 121456152) is 4-azatricyclo[6.2.1.01,6]undeca-2,4,7,9-tetraene.
What is the SMILES notation for 4-azatricyclo[6.2.1.01,6]undeca-2,4,7,9-tetraene?
The canonical SMILES for 4-azatricyclo[6.2.1.01,6]undeca-2,4,7,9-tetraene is C1=CC23C=CC(=CC2C=N1)C3.
What is the InChIKey of 4-azatricyclo[6.2.1.01,6]undeca-2,4,7,9-tetraene?
The InChIKey is NCVRTIARNVYGKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N/c1-2-10-3-4-11-7-9(10)5-8(1)6-10/h1-5,7,9H,6H2.
What are the key properties of 4-azatricyclo[6.2.1.01,6]undeca-2,4,7,9-tetraene?
4-azatricyclo[6.2.1.01,6]undeca-2,4,7,9-tetraene has a molecular weight of 143.19 g/mol, XLogP of 2.09, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-azatricyclo[6.2.1.01,6]undeca-2,4,7,9-tetraene is sourced from PubChem (CID 121456152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).