C16H19ClN4O — CID 121456376
(6R,8aS)-6-(8-chloroimidazo[1,5-a]pyrazin-3-yl)-2,2-dimethyl-1,5,6,7,8,8a-hexahydroindolizin-3-one (PubChem CID 121456376) has the molecular formula C16H19ClN4O and a molecular weight of 318.81 g/mol. Its IUPAC name is (6R,8aS)-6-(8-chloroimidazo[1,5-a]pyrazin-3-yl)-2,2-dimethyl-1,5,6,7,8,8a-hexahydroindolizin-3-one.
| Compound Name | (6R,8aS)-6-(8-chloroimidazo[1,5-a]pyrazin-3-yl)-2,2-dimethyl-1,5,6,7,8,8a-hexahydroindolizin-3-one |
|---|---|
| PubChem CID | 121456376 |
| Molecular Formula | C16H19ClN4O |
| Molecular Weight | 318.81 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | (6R,8aS)-6-(8-chloroimidazo[1,5-a]pyrazin-3-yl)-2,2-dimethyl-1,5,6,7,8,8a-hexahydroindolizin-3-one |
| SMILES | CC1(C)C[C@@H]2CC[C@@H](c3ncc4c(Cl)nccn34)CN2C1=O |
| InChI | InChI=1S/C16H19ClN4O/c1-16(2)7-11-4-3-10(9-21(11)15(16)22)14-19-8-12-13(17)18-5-6-20(12)14/h5-6,8,10-11H,3-4,7,9H2,1-2H3/t10-,11+/m1/s1 |
| InChIKey | XYLWPGZNWSGLLL-MNOVXSKESA-N |
| XLogP | 2.89 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.81 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |