C68H44N8O8 — CID 121456409
21,22-dihydroporphyrin;4-[2,3,21-tris(4-carboxyphenyl)-23H-porphyrin-5-yl]benzoic acid (PubChem CID 121456409) has the molecular formula C68H44N8O8 and a molecular weight of 1101.15 g/mol. Its IUPAC name is 21,22-dihydroporphyrin;4-[2,3,21-tris(4-carboxyphenyl)-23H-porphyrin-5-yl]benzoic acid.
| Compound Name | 21,22-dihydroporphyrin;4-[2,3,21-tris(4-carboxyphenyl)-23H-porphyrin-5-yl]benzoic acid |
|---|---|
| PubChem CID | 121456409 |
| Molecular Formula | C68H44N8O8 |
| Molecular Weight | 1101.15 g/mol |
| Exact Mass | 1100.33 |
| IUPAC Name | 21,22-dihydroporphyrin;4-[2,3,21-tris(4-carboxyphenyl)-23H-porphyrin-5-yl]benzoic acid |
| SMILES | C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.O=C(O)c1ccc(-c2c(-c3ccc(C(=O)O)cc3)c3c(-c4ccc(C(=O)O)cc4)c4nc(cc5ccc(cc6nc(cc2n3-c2ccc(C(=O)O)cc2)C=C6)[nH]5)C=C4)cc1 |
| InChI | InChI=1S/C48H30N4O8.C20H14N4/c53-45(54)29-7-1-26(2-8-29)41-39-22-19-36(51-39)24-35-16-15-33(49-35)23-34-17-18-37(50-34)25-40-42(27-3-9-30(10-4-27)46(55)56)43(28-5-11-31(12-6-28)47(57)58)44(41)52(40)38-20-13-32(14-21-38)48(59)60;1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14/h1-25,49H,(H,53,54)(H,55,56)(H,57,58)(H,59,60);1-12,21-22H/b33-23-,34-23-,35-24-,36-24-,37-25-,40-25-,41-39-,44-41-;13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12- |
| InChIKey | JTDSEYZVHDMOIN-XFLVUXMMSA-N |
| XLogP | 14.57 |
| TPSA | 253.06 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 84 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1101.15 |
| LogP ≤ 5 | 14.57 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |