C29H27F4N5O2 — CID 121456508
(6R,8aS)-6-[8-amino-1-[4-[1-[3-(difluoromethyl)phenyl]-1-hydroxyethyl]-2-fluorophenyl]-5-fluoroimidazo[1,5-a]pyrazin-3-yl]-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one (PubChem CID 121456508) has the molecular formula C29H27F4N5O2 and a molecular weight of 553.56 g/mol. Its IUPAC name is (6R,8aS)-6-[8-amino-1-[4-[1-[3-(difluoromethyl)phenyl]-1-hydroxyethyl]-2-fluorophenyl]-5-fluoroimidazo[1,5-a]pyrazin-3-yl]-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one.
| Compound Name | (6R,8aS)-6-[8-amino-1-[4-[1-[3-(difluoromethyl)phenyl]-1-hydroxyethyl]-2-fluorophenyl]-5-fluoroimidazo[1,5-a]pyrazin-3-yl]-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
|---|---|
| PubChem CID | 121456508 |
| Molecular Formula | C29H27F4N5O2 |
| Molecular Weight | 553.56 g/mol |
| Exact Mass | 553.21 |
| IUPAC Name | (6R,8aS)-6-[8-amino-1-[4-[1-[3-(difluoromethyl)phenyl]-1-hydroxyethyl]-2-fluorophenyl]-5-fluoroimidazo[1,5-a]pyrazin-3-yl]-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
| SMILES | CC(O)(c1cccc(C(F)F)c1)c1ccc(-c2nc([C@@H]3CC[C@H]4CCC(=O)N4C3)n3c(F)cnc(N)c23)c(F)c1 |
| InChI | InChI=1S/C29H27F4N5O2/c1-29(40,17-4-2-3-15(11-17)26(32)33)18-6-9-20(21(30)12-18)24-25-27(34)35-13-22(31)38(25)28(36-24)16-5-7-19-8-10-23(39)37(19)14-16/h2-4,6,9,11-13,16,19,26,40H,5,7-8,10,14H2,1H3,(H2,34,35)/t16-,19+,29?/m1/s1 |
| InChIKey | UFVSZKNMRZZFKO-BGEIZJPRSA-N |
| XLogP | 5.32 |
| TPSA | 96.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.56 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |