C30H37N5O2 — CID 121456511
(6R,8aS)-6-[8-amino-1-[4-[1-(2-bicyclo[2.2.2]octanyl)-1-hydroxyethyl]phenyl]imidazo[1,5-a]pyrazin-3-yl]-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one (PubChem CID 121456511) has the molecular formula C30H37N5O2 and a molecular weight of 499.66 g/mol. Its IUPAC name is (6R,8aS)-6-[8-amino-1-[4-[1-(2-bicyclo[2.2.2]octanyl)-1-hydroxyethyl]phenyl]imidazo[1,5-a]pyrazin-3-yl]-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one.
| Compound Name | (6R,8aS)-6-[8-amino-1-[4-[1-(2-bicyclo[2.2.2]octanyl)-1-hydroxyethyl]phenyl]imidazo[1,5-a]pyrazin-3-yl]-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
|---|---|
| PubChem CID | 121456511 |
| Molecular Formula | C30H37N5O2 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.29 |
| IUPAC Name | (6R,8aS)-6-[8-amino-1-[4-[1-(2-bicyclo[2.2.2]octanyl)-1-hydroxyethyl]phenyl]imidazo[1,5-a]pyrazin-3-yl]-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
| SMILES | CC(O)(c1ccc(-c2nc([C@@H]3CC[C@H]4CCC(=O)N4C3)n3ccnc(N)c23)cc1)C1CC2CCC1CC2 |
| InChI | InChI=1S/C30H37N5O2/c1-30(37,24-16-18-2-4-19(24)5-3-18)22-9-6-20(7-10-22)26-27-28(31)32-14-15-34(27)29(33-26)21-8-11-23-12-13-25(36)35(23)17-21/h6-7,9-10,14-15,18-19,21,23-24,37H,2-5,8,11-13,16-17H2,1H3,(H2,31,32)/t18?,19?,21-,23+,24?,30?/m1/s1 |
| InChIKey | HBUGUZPBEIHZGW-ZTYWHGMRSA-N |
| XLogP | 4.88 |
| TPSA | 96.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |