C28H28FN5O2 — CID 121456560
(6R,8aS)-6-[8-amino-1-[4-[1-(3-fluorophenyl)-1-hydroxyethyl]phenyl]imidazo[1,5-a]pyrazin-3-yl]-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one (PubChem CID 121456560) has the molecular formula C28H28FN5O2 and a molecular weight of 485.56 g/mol. Its IUPAC name is (6R,8aS)-6-[8-amino-1-[4-[1-(3-fluorophenyl)-1-hydroxyethyl]phenyl]imidazo[1,5-a]pyrazin-3-yl]-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one.
| Compound Name | (6R,8aS)-6-[8-amino-1-[4-[1-(3-fluorophenyl)-1-hydroxyethyl]phenyl]imidazo[1,5-a]pyrazin-3-yl]-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
|---|---|
| PubChem CID | 121456560 |
| Molecular Formula | C28H28FN5O2 |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | (6R,8aS)-6-[8-amino-1-[4-[1-(3-fluorophenyl)-1-hydroxyethyl]phenyl]imidazo[1,5-a]pyrazin-3-yl]-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
| SMILES | CC(O)(c1ccc(-c2nc([C@@H]3CC[C@H]4CCC(=O)N4C3)n3ccnc(N)c23)cc1)c1cccc(F)c1 |
| InChI | InChI=1S/C28H28FN5O2/c1-28(36,20-3-2-4-21(29)15-20)19-8-5-17(6-9-19)24-25-26(30)31-13-14-33(25)27(32-24)18-7-10-22-11-12-23(35)34(22)16-18/h2-6,8-9,13-15,18,22,36H,7,10-12,16H2,1H3,(H2,30,31)/t18-,22+,28?/m1/s1 |
| InChIKey | NTFCXLFOYYSOBK-GPDABROOSA-N |
| XLogP | 4.24 |
| TPSA | 96.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |