C31H32F3N5O2 — CID 121456572
(6R,8aS)-6-[8-amino-1-[4-[1-[3-(difluoromethyl)phenyl]-1-hydroxyethyl]-2-fluorophenyl]imidazo[1,5-a]pyrazin-3-yl]-2,2-dimethyl-1,5,6,7,8,8a-hexahydroindolizin-3-one (PubChem CID 121456572) has the molecular formula C31H32F3N5O2 and a molecular weight of 563.62 g/mol. Its IUPAC name is (6R,8aS)-6-[8-amino-1-[4-[1-[3-(difluoromethyl)phenyl]-1-hydroxyethyl]-2-fluorophenyl]imidazo[1,5-a]pyrazin-3-yl]-2,2-dimethyl-1,5,6,7,8,8a-hexahydroindolizin-3-one.
| Compound Name | (6R,8aS)-6-[8-amino-1-[4-[1-[3-(difluoromethyl)phenyl]-1-hydroxyethyl]-2-fluorophenyl]imidazo[1,5-a]pyrazin-3-yl]-2,2-dimethyl-1,5,6,7,8,8a-hexahydroindolizin-3-one |
|---|---|
| PubChem CID | 121456572 |
| Molecular Formula | C31H32F3N5O2 |
| Molecular Weight | 563.62 g/mol |
| Exact Mass | 563.25 |
| IUPAC Name | (6R,8aS)-6-[8-amino-1-[4-[1-[3-(difluoromethyl)phenyl]-1-hydroxyethyl]-2-fluorophenyl]imidazo[1,5-a]pyrazin-3-yl]-2,2-dimethyl-1,5,6,7,8,8a-hexahydroindolizin-3-one |
| SMILES | CC1(C)C[C@@H]2CC[C@@H](c3nc(-c4ccc(C(C)(O)c5cccc(C(F)F)c5)cc4F)c4c(N)nccn34)CN2C1=O |
| InChI | InChI=1S/C31H32F3N5O2/c1-30(2)15-21-9-7-18(16-39(21)29(30)40)28-37-24(25-27(35)36-11-12-38(25)28)22-10-8-20(14-23(22)32)31(3,41)19-6-4-5-17(13-19)26(33)34/h4-6,8,10-14,18,21,26,41H,7,9,15-16H2,1-3H3,(H2,35,36)/t18-,21+,31?/m1/s1 |
| InChIKey | KABYMZCEWYQYPK-OXKZSOBJSA-N |
| XLogP | 5.82 |
| TPSA | 96.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.62 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |