About 1-(3,4-dimethoxyphenyl)-N-methylimidazo[1,2-a]quinoxalin-4-amine
1-(3,4-dimethoxyphenyl)-N-methylimidazo[1,2-a]quinoxalin-4-amine (PubChem CID 121457308) has the molecular formula C19H18N4O2
and a molecular weight of 334.38 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-N-methylimidazo[1,2-a]quinoxalin-4-amine.
Molecular Properties
| Compound Name | 1-(3,4-dimethoxyphenyl)-N-methylimidazo[1,2-a]quinoxalin-4-amine |
| PubChem CID | 121457308 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-N-methylimidazo[1,2-a]quinoxalin-4-amine |
| SMILES | CNc1nc2ccccc2n2c(-c3ccc(OC)c(OC)c3)cnc12 |
| InChI | InChI=1S/C19H18N4O2/c1-20-18-19-21-11-15(12-8-9-16(24-2)17(10-12)25-3)23(19)14-7-5-4-6-13(14)22-18/h4-11H,1-3H3,(H,20,22) |
| InChIKey | VDOWSTKRHUQHPI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(3,4-dimethoxyphenyl)-N-methylimidazo[1,2-a]quinoxalin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dimethoxyphenyl)-N-methylimidazo[1,2-a]quinoxalin-4-amine?
The IUPAC name of 1-(3,4-dimethoxyphenyl)-N-methylimidazo[1,2-a]quinoxalin-4-amine (CID 121457308) is 1-(3,4-dimethoxyphenyl)-N-methylimidazo[1,2-a]quinoxalin-4-amine.
What is the SMILES notation for 1-(3,4-dimethoxyphenyl)-N-methylimidazo[1,2-a]quinoxalin-4-amine?
The canonical SMILES for 1-(3,4-dimethoxyphenyl)-N-methylimidazo[1,2-a]quinoxalin-4-amine is CNc1nc2ccccc2n2c(-c3ccc(OC)c(OC)c3)cnc12.
What is the InChIKey of 1-(3,4-dimethoxyphenyl)-N-methylimidazo[1,2-a]quinoxalin-4-amine?
The InChIKey is VDOWSTKRHUQHPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N4O2/c1-20-18-19-21-11-15(12-8-9-16(24-2)17(10-12)25-3)23(19)14-7-5-4-6-13(14)22-18/h4-11H,1-3H3,(H,20,22).
What are the key properties of 1-(3,4-dimethoxyphenyl)-N-methylimidazo[1,2-a]quinoxalin-4-amine?
1-(3,4-dimethoxyphenyl)-N-methylimidazo[1,2-a]quinoxalin-4-amine has a molecular weight of 334.38 g/mol, XLogP of 3.61, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dimethoxyphenyl)-N-methylimidazo[1,2-a]quinoxalin-4-amine is sourced from PubChem (CID 121457308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).