About [3-(1,3-benzothiazole-2-carbonyl)-1-phenylpyrazol-4-yl]-(furan-2-yl)methanone
[3-(1,3-benzothiazole-2-carbonyl)-1-phenylpyrazol-4-yl]-(furan-2-yl)methanone (PubChem CID 1214574) has the molecular formula C22H13N3O3S
and a molecular weight of 399.43 g/mol. Its IUPAC name is [3-(1,3-benzothiazole-2-carbonyl)-1-phenylpyrazol-4-yl]-(furan-2-yl)methanone.
Molecular Properties
| Compound Name | [3-(1,3-benzothiazole-2-carbonyl)-1-phenylpyrazol-4-yl]-(furan-2-yl)methanone |
| PubChem CID | 1214574 |
| Molecular Formula | C22H13N3O3S |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | [3-(1,3-benzothiazole-2-carbonyl)-1-phenylpyrazol-4-yl]-(furan-2-yl)methanone |
| SMILES | O=C(c1ccco1)c1cn(-c2ccccc2)nc1C(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C22H13N3O3S/c26-20(17-10-6-12-28-17)15-13-25(14-7-2-1-3-8-14)24-19(15)21(27)22-23-16-9-4-5-11-18(16)29-22/h1-13H |
| InChIKey | BMPIZTCXBSACNP-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 77.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [3-(1,3-benzothiazole-2-carbonyl)-1-phenylpyrazol-4-yl]-(furan-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1,3-benzothiazole-2-carbonyl)-1-phenylpyrazol-4-yl]-(furan-2-yl)methanone?
The IUPAC name of [3-(1,3-benzothiazole-2-carbonyl)-1-phenylpyrazol-4-yl]-(furan-2-yl)methanone (CID 1214574) is [3-(1,3-benzothiazole-2-carbonyl)-1-phenylpyrazol-4-yl]-(furan-2-yl)methanone.
What is the SMILES notation for [3-(1,3-benzothiazole-2-carbonyl)-1-phenylpyrazol-4-yl]-(furan-2-yl)methanone?
The canonical SMILES for [3-(1,3-benzothiazole-2-carbonyl)-1-phenylpyrazol-4-yl]-(furan-2-yl)methanone is O=C(c1ccco1)c1cn(-c2ccccc2)nc1C(=O)c1nc2ccccc2s1.
What is the InChIKey of [3-(1,3-benzothiazole-2-carbonyl)-1-phenylpyrazol-4-yl]-(furan-2-yl)methanone?
The InChIKey is BMPIZTCXBSACNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H13N3O3S/c26-20(17-10-6-12-28-17)15-13-25(14-7-2-1-3-8-14)24-19(15)21(27)22-23-16-9-4-5-11-18(16)29-22/h1-13H.
What are the key properties of [3-(1,3-benzothiazole-2-carbonyl)-1-phenylpyrazol-4-yl]-(furan-2-yl)methanone?
[3-(1,3-benzothiazole-2-carbonyl)-1-phenylpyrazol-4-yl]-(furan-2-yl)methanone has a molecular weight of 399.43 g/mol, XLogP of 4.54, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1,3-benzothiazole-2-carbonyl)-1-phenylpyrazol-4-yl]-(furan-2-yl)methanone is sourced from PubChem (CID 1214574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).