C30H32F2N4O3 — CID 121457543
trans-(1S,3R)-3-[8-amino-1-[4-[(1R)-1-[3-(difluoromethyl)phenyl]-1-hydroxyethyl]phenyl]imidazo[1,5-a]pyrazin-3-yl]-1,2,2-trimethylcyclopentane-1-carboxylic acid (PubChem CID 121457543) has the molecular formula C30H32F2N4O3 and a molecular weight of 534.61 g/mol. Its IUPAC name is trans-(1S,3R)-3-[8-amino-1-[4-[(1R)-1-[3-(difluoromethyl)phenyl]-1-hydroxyethyl]phenyl]imidazo[1,5-a]pyrazin-3-yl]-1,2,2-trimethylcyclopentane-1-carboxylic acid.
| Compound Name | trans-(1S,3R)-3-[8-amino-1-[4-[(1R)-1-[3-(difluoromethyl)phenyl]-1-hydroxyethyl]phenyl]imidazo[1,5-a]pyrazin-3-yl]-1,2,2-trimethylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 121457543 |
| Molecular Formula | C30H32F2N4O3 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | trans-(1S,3R)-3-[8-amino-1-[4-[(1R)-1-[3-(difluoromethyl)phenyl]-1-hydroxyethyl]phenyl]imidazo[1,5-a]pyrazin-3-yl]-1,2,2-trimethylcyclopentane-1-carboxylic acid |
| SMILES | CC1(C)[C@H](c2nc(-c3ccc([C@@](C)(O)c4cccc(C(F)F)c4)cc3)c3c(N)nccn23)CC[C@]1(C)C(=O)O |
| InChI | InChI=1S/C30H32F2N4O3/c1-28(2)21(12-13-29(28,3)27(37)38)26-35-22(23-25(33)34-14-15-36(23)26)17-8-10-19(11-9-17)30(4,39)20-7-5-6-18(16-20)24(31)32/h5-11,14-16,21,24,39H,12-13H2,1-4H3,(H2,33,34)(H,37,38)/t21-,29+,30+/m0/s1 |
| InChIKey | IXKGSENIBWVWIY-AUMPPRDSSA-N |
| XLogP | 6.17 |
| TPSA | 113.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |