About 2-[3-phenyl-4-(4-sulfamoylphenoxy)pyrazol-1-yl]-1,3-thiazole-4-carboxylic acid
2-[3-phenyl-4-(4-sulfamoylphenoxy)pyrazol-1-yl]-1,3-thiazole-4-carboxylic acid (PubChem CID 121457599) has the molecular formula C19H14N4O5S2
and a molecular weight of 442.48 g/mol. Its IUPAC name is 2-[3-phenyl-4-(4-sulfamoylphenoxy)pyrazol-1-yl]-1,3-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-[3-phenyl-4-(4-sulfamoylphenoxy)pyrazol-1-yl]-1,3-thiazole-4-carboxylic acid |
| PubChem CID | 121457599 |
| Molecular Formula | C19H14N4O5S2 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | 2-[3-phenyl-4-(4-sulfamoylphenoxy)pyrazol-1-yl]-1,3-thiazole-4-carboxylic acid |
| SMILES | NS(=O)(=O)c1ccc(Oc2cn(-c3nc(C(=O)O)cs3)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C19H14N4O5S2/c20-30(26,27)14-8-6-13(7-9-14)28-16-10-23(19-21-15(11-29-19)18(24)25)22-17(16)12-4-2-1-3-5-12/h1-11H,(H,24,25)(H2,20,26,27) |
| InChIKey | MHQJLGSHTNDCGV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 137.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-[3-phenyl-4-(4-sulfamoylphenoxy)pyrazol-1-yl]-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-phenyl-4-(4-sulfamoylphenoxy)pyrazol-1-yl]-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 2-[3-phenyl-4-(4-sulfamoylphenoxy)pyrazol-1-yl]-1,3-thiazole-4-carboxylic acid (CID 121457599) is 2-[3-phenyl-4-(4-sulfamoylphenoxy)pyrazol-1-yl]-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 2-[3-phenyl-4-(4-sulfamoylphenoxy)pyrazol-1-yl]-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 2-[3-phenyl-4-(4-sulfamoylphenoxy)pyrazol-1-yl]-1,3-thiazole-4-carboxylic acid is NS(=O)(=O)c1ccc(Oc2cn(-c3nc(C(=O)O)cs3)nc2-c2ccccc2)cc1.
What is the InChIKey of 2-[3-phenyl-4-(4-sulfamoylphenoxy)pyrazol-1-yl]-1,3-thiazole-4-carboxylic acid?
The InChIKey is MHQJLGSHTNDCGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14N4O5S2/c20-30(26,27)14-8-6-13(7-9-14)28-16-10-23(19-21-15(11-29-19)18(24)25)22-17(16)12-4-2-1-3-5-12/h1-11H,(H,24,25)(H2,20,26,27).
What are the key properties of 2-[3-phenyl-4-(4-sulfamoylphenoxy)pyrazol-1-yl]-1,3-thiazole-4-carboxylic acid?
2-[3-phenyl-4-(4-sulfamoylphenoxy)pyrazol-1-yl]-1,3-thiazole-4-carboxylic acid has a molecular weight of 442.48 g/mol, XLogP of 3.13, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-phenyl-4-(4-sulfamoylphenoxy)pyrazol-1-yl]-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 121457599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).