C16H19N3O5 — CID 121458203
11-hydroxy-5-(3-methoxypropyl)-13-oxo-4,5,14-triazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11-tetraene-12-carboxylic acid (PubChem CID 121458203) has the molecular formula C16H19N3O5 and a molecular weight of 333.34 g/mol. Its IUPAC name is 11-hydroxy-5-(3-methoxypropyl)-13-oxo-4,5,14-triazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11-tetraene-12-carboxylic acid.
| Compound Name | 11-hydroxy-5-(3-methoxypropyl)-13-oxo-4,5,14-triazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11-tetraene-12-carboxylic acid |
|---|---|
| PubChem CID | 121458203 |
| Molecular Formula | C16H19N3O5 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 11-hydroxy-5-(3-methoxypropyl)-13-oxo-4,5,14-triazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11-tetraene-12-carboxylic acid |
| SMILES | COCCCn1ncc2c1CCCc1c-2[nH]c(=O)c(C(=O)O)c1O |
| InChI | InChI=1S/C16H19N3O5/c1-24-7-3-6-19-11-5-2-4-9-13(10(11)8-17-19)18-15(21)12(14(9)20)16(22)23/h8H,2-7H2,1H3,(H,22,23)(H2,18,20,21) |
| InChIKey | XGAWWSFZEQSHGG-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 117.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|