About 2-(5-methoxycyclohexa-1,3-dien-1-yl)piperazine
2-(5-methoxycyclohexa-1,3-dien-1-yl)piperazine (PubChem CID 121458376) has the molecular formula C11H18N2O
and a molecular weight of 194.28 g/mol. Its IUPAC name is 2-(5-methoxycyclohexa-1,3-dien-1-yl)piperazine.
Molecular Properties
| Compound Name | 2-(5-methoxycyclohexa-1,3-dien-1-yl)piperazine |
| PubChem CID | 121458376 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 2-(5-methoxycyclohexa-1,3-dien-1-yl)piperazine |
| SMILES | COC1C=CC=C(C2CNCCN2)C1 |
| InChI | InChI=1S/C11H18N2O/c1-14-10-4-2-3-9(7-10)11-8-12-5-6-13-11/h2-4,10-13H,5-8H2,1H3 |
| InChIKey | ACKPDNMEJXZMNX-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(5-methoxycyclohexa-1,3-dien-1-yl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-methoxycyclohexa-1,3-dien-1-yl)piperazine?
The IUPAC name of 2-(5-methoxycyclohexa-1,3-dien-1-yl)piperazine (CID 121458376) is 2-(5-methoxycyclohexa-1,3-dien-1-yl)piperazine.
What is the SMILES notation for 2-(5-methoxycyclohexa-1,3-dien-1-yl)piperazine?
The canonical SMILES for 2-(5-methoxycyclohexa-1,3-dien-1-yl)piperazine is COC1C=CC=C(C2CNCCN2)C1.
What is the InChIKey of 2-(5-methoxycyclohexa-1,3-dien-1-yl)piperazine?
The InChIKey is ACKPDNMEJXZMNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O/c1-14-10-4-2-3-9(7-10)11-8-12-5-6-13-11/h2-4,10-13H,5-8H2,1H3.
What are the key properties of 2-(5-methoxycyclohexa-1,3-dien-1-yl)piperazine?
2-(5-methoxycyclohexa-1,3-dien-1-yl)piperazine has a molecular weight of 194.28 g/mol, XLogP of 0.45, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-methoxycyclohexa-1,3-dien-1-yl)piperazine is sourced from PubChem (CID 121458376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).