About 4,5-bis(2-fluorophenyl)-2-[2-(3-methoxyphenyl)ethyl]-1,3-oxazole
4,5-bis(2-fluorophenyl)-2-[2-(3-methoxyphenyl)ethyl]-1,3-oxazole (PubChem CID 121458505) has the molecular formula C24H19F2NO2
and a molecular weight of 391.42 g/mol. Its IUPAC name is 4,5-bis(2-fluorophenyl)-2-[2-(3-methoxyphenyl)ethyl]-1,3-oxazole.
Molecular Properties
| Compound Name | 4,5-bis(2-fluorophenyl)-2-[2-(3-methoxyphenyl)ethyl]-1,3-oxazole |
| PubChem CID | 121458505 |
| Molecular Formula | C24H19F2NO2 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 4,5-bis(2-fluorophenyl)-2-[2-(3-methoxyphenyl)ethyl]-1,3-oxazole |
| SMILES | COc1cccc(CCc2nc(-c3ccccc3F)c(-c3ccccc3F)o2)c1 |
| InChI | InChI=1S/C24H19F2NO2/c1-28-17-8-6-7-16(15-17)13-14-22-27-23(18-9-2-4-11-20(18)25)24(29-22)19-10-3-5-12-21(19)26/h2-12,15H,13-14H2,1H3 |
| InChIKey | SINDELGQZDQOLF-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,5-bis(2-fluorophenyl)-2-[2-(3-methoxyphenyl)ethyl]-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-bis(2-fluorophenyl)-2-[2-(3-methoxyphenyl)ethyl]-1,3-oxazole?
The IUPAC name of 4,5-bis(2-fluorophenyl)-2-[2-(3-methoxyphenyl)ethyl]-1,3-oxazole (CID 121458505) is 4,5-bis(2-fluorophenyl)-2-[2-(3-methoxyphenyl)ethyl]-1,3-oxazole.
What is the SMILES notation for 4,5-bis(2-fluorophenyl)-2-[2-(3-methoxyphenyl)ethyl]-1,3-oxazole?
The canonical SMILES for 4,5-bis(2-fluorophenyl)-2-[2-(3-methoxyphenyl)ethyl]-1,3-oxazole is COc1cccc(CCc2nc(-c3ccccc3F)c(-c3ccccc3F)o2)c1.
What is the InChIKey of 4,5-bis(2-fluorophenyl)-2-[2-(3-methoxyphenyl)ethyl]-1,3-oxazole?
The InChIKey is SINDELGQZDQOLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19F2NO2/c1-28-17-8-6-7-16(15-17)13-14-22-27-23(18-9-2-4-11-20(18)25)24(29-22)19-10-3-5-12-21(19)26/h2-12,15H,13-14H2,1H3.
What are the key properties of 4,5-bis(2-fluorophenyl)-2-[2-(3-methoxyphenyl)ethyl]-1,3-oxazole?
4,5-bis(2-fluorophenyl)-2-[2-(3-methoxyphenyl)ethyl]-1,3-oxazole has a molecular weight of 391.42 g/mol, XLogP of 6.08, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-bis(2-fluorophenyl)-2-[2-(3-methoxyphenyl)ethyl]-1,3-oxazole is sourced from PubChem (CID 121458505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).