C24H25NO6 — CID 121458930
(4-nitrophenyl) 3-[(5S)-2,5,7-trimethyl-4-oxospiro[5H-indene-6,1'-cyclopropane]-1-yl]propyl carbonate (PubChem CID 121458930) has the molecular formula C24H25NO6 and a molecular weight of 423.47 g/mol. Its IUPAC name is (4-nitrophenyl) 3-[(5S)-2,5,7-trimethyl-4-oxospiro[5H-indene-6,1'-cyclopropane]-1-yl]propyl carbonate.
| Compound Name | (4-nitrophenyl) 3-[(5S)-2,5,7-trimethyl-4-oxospiro[5H-indene-6,1'-cyclopropane]-1-yl]propyl carbonate |
|---|---|
| PubChem CID | 121458930 |
| Molecular Formula | C24H25NO6 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | (4-nitrophenyl) 3-[(5S)-2,5,7-trimethyl-4-oxospiro[5H-indene-6,1'-cyclopropane]-1-yl]propyl carbonate |
| SMILES | CC1=C(CCCOC(=O)Oc2ccc([N+](=O)[O-])cc2)C2=C(C)C3(CC3)[C@H](C)C(=O)C2=C1 |
| InChI | InChI=1S/C24H25NO6/c1-14-13-20-21(15(2)24(10-11-24)16(3)22(20)26)19(14)5-4-12-30-23(27)31-18-8-6-17(7-9-18)25(28)29/h6-9,13,16H,4-5,10-12H2,1-3H3/t16-/m1/s1 |
| InChIKey | UDCJJNABZKOSAP-MRXNPFEDSA-N |
| XLogP | 5.46 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|