C24H28O3S — CID 121458939
(5'R)-5'-hydroxy-2',5',7'-trimethyl-1'-[3-(4-methylphenyl)sulfanyloxypropyl]spiro[cyclopropane-1,6'-indene]-4'-one (PubChem CID 121458939) has the molecular formula C24H28O3S and a molecular weight of 396.55 g/mol. Its IUPAC name is (5'R)-5'-hydroxy-2',5',7'-trimethyl-1'-[3-(4-methylphenyl)sulfanyloxypropyl]spiro[cyclopropane-1,6'-indene]-4'-one.
| Compound Name | (5'R)-5'-hydroxy-2',5',7'-trimethyl-1'-[3-(4-methylphenyl)sulfanyloxypropyl]spiro[cyclopropane-1,6'-indene]-4'-one |
|---|---|
| PubChem CID | 121458939 |
| Molecular Formula | C24H28O3S |
| Molecular Weight | 396.55 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | (5'R)-5'-hydroxy-2',5',7'-trimethyl-1'-[3-(4-methylphenyl)sulfanyloxypropyl]spiro[cyclopropane-1,6'-indene]-4'-one |
| SMILES | CC1=C(CCCOSc2ccc(C)cc2)C2=C(C)C3(CC3)[C@@](C)(O)C(=O)C2=C1 |
| InChI | InChI=1S/C24H28O3S/c1-15-7-9-18(10-8-15)28-27-13-5-6-19-16(2)14-20-21(19)17(3)24(11-12-24)23(4,26)22(20)25/h7-10,14,26H,5-6,11-13H2,1-4H3/t23-/m0/s1 |
| InChIKey | KQSVVMIVPIAAPV-QHCPKHFHSA-N |
| XLogP | 5.49 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.55 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|