C7H12O3 — CID 121459311
(3R,3aR,6R,6aS)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-3,6-diol (PubChem CID 121459311) has the molecular formula C7H12O3 and a molecular weight of 144.17 g/mol. Its IUPAC name is (3R,3aR,6R,6aS)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-3,6-diol.
| Compound Name | (3R,3aR,6R,6aS)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-3,6-diol |
|---|---|
| PubChem CID | 121459311 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | (3R,3aR,6R,6aS)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-3,6-diol |
| SMILES | O[C@@H]1CC[C@H]2[C@@H]1OC[C@@H]2O |
| InChI | InChI=1S/C7H12O3/c8-5-2-1-4-6(9)3-10-7(4)5/h4-9H,1-3H2/t4-,5-,6+,7+/m1/s1 |
| InChIKey | BAMJEYYLHGJATQ-JWXFUTCRSA-N |
| XLogP | -0.48 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |