About 1-(5-fluoro-2,4-dioxopyrimidin-1-yl)ethyl 1-tert-butylpyrrolidine-2-carboxylate
1-(5-fluoro-2,4-dioxopyrimidin-1-yl)ethyl 1-tert-butylpyrrolidine-2-carboxylate (PubChem CID 121459567) has the molecular formula C15H22FN3O4
and a molecular weight of 327.36 g/mol. Its IUPAC name is 1-(5-fluoro-2,4-dioxopyrimidin-1-yl)ethyl 1-tert-butylpyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | 1-(5-fluoro-2,4-dioxopyrimidin-1-yl)ethyl 1-tert-butylpyrrolidine-2-carboxylate |
| PubChem CID | 121459567 |
| Molecular Formula | C15H22FN3O4 |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 1-(5-fluoro-2,4-dioxopyrimidin-1-yl)ethyl 1-tert-butylpyrrolidine-2-carboxylate |
| SMILES | CC(OC(=O)C1CCCN1C(C)(C)C)n1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H22FN3O4/c1-9(18-8-10(16)12(20)17-14(18)22)23-13(21)11-6-5-7-19(11)15(2,3)4/h8-9,11H,5-7H2,1-4H3,(H,17,20,22) |
| InChIKey | AXMATSSAIQRGKO-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 84.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(5-fluoro-2,4-dioxopyrimidin-1-yl)ethyl 1-tert-butylpyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-fluoro-2,4-dioxopyrimidin-1-yl)ethyl 1-tert-butylpyrrolidine-2-carboxylate?
The IUPAC name of 1-(5-fluoro-2,4-dioxopyrimidin-1-yl)ethyl 1-tert-butylpyrrolidine-2-carboxylate (CID 121459567) is 1-(5-fluoro-2,4-dioxopyrimidin-1-yl)ethyl 1-tert-butylpyrrolidine-2-carboxylate.
What is the SMILES notation for 1-(5-fluoro-2,4-dioxopyrimidin-1-yl)ethyl 1-tert-butylpyrrolidine-2-carboxylate?
The canonical SMILES for 1-(5-fluoro-2,4-dioxopyrimidin-1-yl)ethyl 1-tert-butylpyrrolidine-2-carboxylate is CC(OC(=O)C1CCCN1C(C)(C)C)n1cc(F)c(=O)[nH]c1=O.
What is the InChIKey of 1-(5-fluoro-2,4-dioxopyrimidin-1-yl)ethyl 1-tert-butylpyrrolidine-2-carboxylate?
The InChIKey is AXMATSSAIQRGKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22FN3O4/c1-9(18-8-10(16)12(20)17-14(18)22)23-13(21)11-6-5-7-19(11)15(2,3)4/h8-9,11H,5-7H2,1-4H3,(H,17,20,22).
What are the key properties of 1-(5-fluoro-2,4-dioxopyrimidin-1-yl)ethyl 1-tert-butylpyrrolidine-2-carboxylate?
1-(5-fluoro-2,4-dioxopyrimidin-1-yl)ethyl 1-tert-butylpyrrolidine-2-carboxylate has a molecular weight of 327.36 g/mol, XLogP of 1.00, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-fluoro-2,4-dioxopyrimidin-1-yl)ethyl 1-tert-butylpyrrolidine-2-carboxylate is sourced from PubChem (CID 121459567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).