C19H21ClN4S — CID 121459821
N-[6-chloro-2-[(E)-2-thiophen-2-ylethenyl]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 121459821) has the molecular formula C19H21ClN4S and a molecular weight of 372.93 g/mol. Its IUPAC name is N-[6-chloro-2-[(E)-2-thiophen-2-ylethenyl]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[6-chloro-2-[(E)-2-thiophen-2-ylethenyl]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 121459821 |
| Molecular Formula | C19H21ClN4S |
| Molecular Weight | 372.93 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | N-[6-chloro-2-[(E)-2-thiophen-2-ylethenyl]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNc1nc(/C=C/c2cccs2)nc2ccc(Cl)cc12 |
| InChI | InChI=1S/C19H21ClN4S/c1-24(2)11-4-10-21-19-16-13-14(20)6-8-17(16)22-18(23-19)9-7-15-5-3-12-25-15/h3,5-9,12-13H,4,10-11H2,1-2H3,(H,21,22,23)/b9-7+ |
| InChIKey | VDKLCEYLXXDCLA-VQHVLOKHSA-N |
| XLogP | 4.88 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.93 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|