About 6-ethyl-1,2,6-triazaspiro[2.4]hept-1-ene
6-ethyl-1,2,6-triazaspiro[2.4]hept-1-ene (PubChem CID 121460088) has the molecular formula C6H11N3
and a molecular weight of 125.17 g/mol. Its IUPAC name is 6-ethyl-1,2,6-triazaspiro[2.4]hept-1-ene.
Molecular Properties
| Compound Name | 6-ethyl-1,2,6-triazaspiro[2.4]hept-1-ene |
| PubChem CID | 121460088 |
| Molecular Formula | C6H11N3 |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.10 |
| IUPAC Name | 6-ethyl-1,2,6-triazaspiro[2.4]hept-1-ene |
| SMILES | CCN1CCC2(C1)N=N2 |
| InChI | InChI=1S/C6H11N3/c1-2-9-4-3-6(5-9)7-8-6/h2-5H2,1H3 |
| InChIKey | XMEAYMIOEBSAOD-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-ethyl-1,2,6-triazaspiro[2.4]hept-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-1,2,6-triazaspiro[2.4]hept-1-ene?
The IUPAC name of 6-ethyl-1,2,6-triazaspiro[2.4]hept-1-ene (CID 121460088) is 6-ethyl-1,2,6-triazaspiro[2.4]hept-1-ene.
What is the SMILES notation for 6-ethyl-1,2,6-triazaspiro[2.4]hept-1-ene?
The canonical SMILES for 6-ethyl-1,2,6-triazaspiro[2.4]hept-1-ene is CCN1CCC2(C1)N=N2.
What is the InChIKey of 6-ethyl-1,2,6-triazaspiro[2.4]hept-1-ene?
The InChIKey is XMEAYMIOEBSAOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3/c1-2-9-4-3-6(5-9)7-8-6/h2-5H2,1H3.
What are the key properties of 6-ethyl-1,2,6-triazaspiro[2.4]hept-1-ene?
6-ethyl-1,2,6-triazaspiro[2.4]hept-1-ene has a molecular weight of 125.17 g/mol, XLogP of 0.87, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-1,2,6-triazaspiro[2.4]hept-1-ene is sourced from PubChem (CID 121460088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).