C31H38N2O6 — CID 121460128
(2S)-2-acetamido-6-[[2,6-dimethoxy-4-[(2-methyl-3-phenylphenyl)methoxy]phenyl]methylamino]hexanoic acid (PubChem CID 121460128) has the molecular formula C31H38N2O6 and a molecular weight of 534.65 g/mol. Its IUPAC name is (2S)-2-acetamido-6-[[2,6-dimethoxy-4-[(2-methyl-3-phenylphenyl)methoxy]phenyl]methylamino]hexanoic acid.
| Compound Name | (2S)-2-acetamido-6-[[2,6-dimethoxy-4-[(2-methyl-3-phenylphenyl)methoxy]phenyl]methylamino]hexanoic acid |
|---|---|
| PubChem CID | 121460128 |
| Molecular Formula | C31H38N2O6 |
| Molecular Weight | 534.65 g/mol |
| Exact Mass | 534.27 |
| IUPAC Name | (2S)-2-acetamido-6-[[2,6-dimethoxy-4-[(2-methyl-3-phenylphenyl)methoxy]phenyl]methylamino]hexanoic acid |
| SMILES | COc1cc(OCc2cccc(-c3ccccc3)c2C)cc(OC)c1CNCCCC[C@H](NC(C)=O)C(=O)O |
| InChI | InChI=1S/C31H38N2O6/c1-21-24(13-10-14-26(21)23-11-6-5-7-12-23)20-39-25-17-29(37-3)27(30(18-25)38-4)19-32-16-9-8-15-28(31(35)36)33-22(2)34/h5-7,10-14,17-18,28,32H,8-9,15-16,19-20H2,1-4H3,(H,33,34)(H,35,36)/t28-/m0/s1 |
| InChIKey | NYTREBUAWJPNNC-NDEPHWFRSA-N |
| XLogP | 5.11 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.65 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|