C24H29BrN6O3 — CID 121460135
(3R,7R,9aS)-7-[1-bromo-8-[(2,4-dimethoxyphenyl)methylamino]imidazo[1,5-a]pyrazin-3-yl]-3-methyl-1,2,3,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-4-one (PubChem CID 121460135) has the molecular formula C24H29BrN6O3 and a molecular weight of 529.44 g/mol. Its IUPAC name is (3R,7R,9aS)-7-[1-bromo-8-[(2,4-dimethoxyphenyl)methylamino]imidazo[1,5-a]pyrazin-3-yl]-3-methyl-1,2,3,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-4-one.
| Compound Name | (3R,7R,9aS)-7-[1-bromo-8-[(2,4-dimethoxyphenyl)methylamino]imidazo[1,5-a]pyrazin-3-yl]-3-methyl-1,2,3,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-4-one |
|---|---|
| PubChem CID | 121460135 |
| Molecular Formula | C24H29BrN6O3 |
| Molecular Weight | 529.44 g/mol |
| Exact Mass | 528.15 |
| IUPAC Name | (3R,7R,9aS)-7-[1-bromo-8-[(2,4-dimethoxyphenyl)methylamino]imidazo[1,5-a]pyrazin-3-yl]-3-methyl-1,2,3,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-4-one |
| SMILES | COc1ccc(CNc2nccn3c([C@@H]4CC[C@H]5CN[C@H](C)C(=O)N5C4)nc(Br)c23)c(OC)c1 |
| InChI | InChI=1S/C24H29BrN6O3/c1-14-24(32)31-13-16(4-6-17(31)12-27-14)23-29-21(25)20-22(26-8-9-30(20)23)28-11-15-5-7-18(33-2)10-19(15)34-3/h5,7-10,14,16-17,27H,4,6,11-13H2,1-3H3,(H,26,28)/t14-,16-,17+/m1/s1 |
| InChIKey | KPFUSSLFIZGNRR-OIISXLGYSA-N |
| XLogP | 3.19 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |