About 7,7-dimethyl-2-(trifluoromethyl)cyclohepta-1,3-dien-5-yne
7,7-dimethyl-2-(trifluoromethyl)cyclohepta-1,3-dien-5-yne (PubChem CID 121460329) has the molecular formula C10H9F3
and a molecular weight of 186.18 g/mol. Its IUPAC name is 7,7-dimethyl-2-(trifluoromethyl)cyclohepta-1,3-dien-5-yne.
Molecular Properties
| Compound Name | 7,7-dimethyl-2-(trifluoromethyl)cyclohepta-1,3-dien-5-yne |
| PubChem CID | 121460329 |
| Molecular Formula | C10H9F3 |
| Molecular Weight | 186.18 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | 7,7-dimethyl-2-(trifluoromethyl)cyclohepta-1,3-dien-5-yne |
| SMILES | CC1(C)C#CC=CC(C(F)(F)F)=C1 |
| InChI | InChI=1S/C10H9F3/c1-9(2)6-4-3-5-8(7-9)10(11,12)13/h3,5,7H,1-2H3 |
| InChIKey | BBRVVXAOOSJNKZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.18 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 7,7-dimethyl-2-(trifluoromethyl)cyclohepta-1,3-dien-5-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,7-dimethyl-2-(trifluoromethyl)cyclohepta-1,3-dien-5-yne?
The IUPAC name of 7,7-dimethyl-2-(trifluoromethyl)cyclohepta-1,3-dien-5-yne (CID 121460329) is 7,7-dimethyl-2-(trifluoromethyl)cyclohepta-1,3-dien-5-yne.
What is the SMILES notation for 7,7-dimethyl-2-(trifluoromethyl)cyclohepta-1,3-dien-5-yne?
The canonical SMILES for 7,7-dimethyl-2-(trifluoromethyl)cyclohepta-1,3-dien-5-yne is CC1(C)C#CC=CC(C(F)(F)F)=C1.
What is the InChIKey of 7,7-dimethyl-2-(trifluoromethyl)cyclohepta-1,3-dien-5-yne?
The InChIKey is BBRVVXAOOSJNKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F3/c1-9(2)6-4-3-5-8(7-9)10(11,12)13/h3,5,7H,1-2H3.
What are the key properties of 7,7-dimethyl-2-(trifluoromethyl)cyclohepta-1,3-dien-5-yne?
7,7-dimethyl-2-(trifluoromethyl)cyclohepta-1,3-dien-5-yne has a molecular weight of 186.18 g/mol, XLogP of 3.07, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7,7-dimethyl-2-(trifluoromethyl)cyclohepta-1,3-dien-5-yne is sourced from PubChem (CID 121460329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).