C11H7F3 — CID 121460360
(3Z,5E)-7-methylidene-5-(trifluoromethyl)nona-3,5-dien-1,8-diyne (PubChem CID 121460360) has the molecular formula C11H7F3 and a molecular weight of 196.17 g/mol. Its IUPAC name is (3Z,5E)-7-methylidene-5-(trifluoromethyl)nona-3,5-dien-1,8-diyne.
| Compound Name | (3Z,5E)-7-methylidene-5-(trifluoromethyl)nona-3,5-dien-1,8-diyne |
|---|---|
| PubChem CID | 121460360 |
| Molecular Formula | C11H7F3 |
| Molecular Weight | 196.17 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | (3Z,5E)-7-methylidene-5-(trifluoromethyl)nona-3,5-dien-1,8-diyne |
| SMILES | C#C/C=C\C(=C/C(=C)C#C)C(F)(F)F |
| InChI | InChI=1S/C11H7F3/c1-4-6-7-10(11(12,13)14)8-9(3)5-2/h1-2,6-8H,3H2/b7-6-,10-8+ |
| InChIKey | WCFMUCUNTZXUAN-VAAURPRASA-N |
| XLogP | 2.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.17 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|