C14H16F6O6S — CID 121460789
[4-[(5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-2,2,3,3-tetrafluorobutyl] 2,2-difluoropropanoate (PubChem CID 121460789) has the molecular formula C14H16F6O6S and a molecular weight of 426.33 g/mol. Its IUPAC name is [4-[(5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-2,2,3,3-tetrafluorobutyl] 2,2-difluoropropanoate.
| Compound Name | [4-[(5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-2,2,3,3-tetrafluorobutyl] 2,2-difluoropropanoate |
|---|---|
| PubChem CID | 121460789 |
| Molecular Formula | C14H16F6O6S |
| Molecular Weight | 426.33 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | [4-[(5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-2,2,3,3-tetrafluorobutyl] 2,2-difluoropropanoate |
| SMILES | CC(F)(F)C(=O)OCC(F)(F)C(F)(F)COC1C2CC3C1OS(=O)(=O)C3C2 |
| InChI | InChI=1S/C14H16F6O6S/c1-12(15,16)11(21)25-5-14(19,20)13(17,18)4-24-9-6-2-7-8(3-6)27(22,23)26-10(7)9/h6-10H,2-5H2,1H3 |
| InChIKey | LMBVAWSRUMKBMM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|