About 1-N-[1-[2-(2,2-dimethylpropylamino)propoxy]propan-2-yl]-2-methylpropane-1,2-diamine
1-N-[1-[2-(2,2-dimethylpropylamino)propoxy]propan-2-yl]-2-methylpropane-1,2-diamine (PubChem CID 121460797) has the molecular formula C15H35N3O
and a molecular weight of 273.46 g/mol. Its IUPAC name is 1-N-[1-[2-(2,2-dimethylpropylamino)propoxy]propan-2-yl]-2-methylpropane-1,2-diamine.
Molecular Properties
| Compound Name | 1-N-[1-[2-(2,2-dimethylpropylamino)propoxy]propan-2-yl]-2-methylpropane-1,2-diamine |
| PubChem CID | 121460797 |
| Molecular Formula | C15H35N3O |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.28 |
| IUPAC Name | 1-N-[1-[2-(2,2-dimethylpropylamino)propoxy]propan-2-yl]-2-methylpropane-1,2-diamine |
| SMILES | CC(COCC(C)NCC(C)(C)N)NCC(C)(C)C |
| InChI | InChI=1S/C15H35N3O/c1-12(17-10-14(3,4)5)8-19-9-13(2)18-11-15(6,7)16/h12-13,17-18H,8-11,16H2,1-7H3 |
| InChIKey | AHSUEKDSMSZQJO-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-N-[1-[2-(2,2-dimethylpropylamino)propoxy]propan-2-yl]-2-methylpropane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-[1-[2-(2,2-dimethylpropylamino)propoxy]propan-2-yl]-2-methylpropane-1,2-diamine?
The IUPAC name of 1-N-[1-[2-(2,2-dimethylpropylamino)propoxy]propan-2-yl]-2-methylpropane-1,2-diamine (CID 121460797) is 1-N-[1-[2-(2,2-dimethylpropylamino)propoxy]propan-2-yl]-2-methylpropane-1,2-diamine.
What is the SMILES notation for 1-N-[1-[2-(2,2-dimethylpropylamino)propoxy]propan-2-yl]-2-methylpropane-1,2-diamine?
The canonical SMILES for 1-N-[1-[2-(2,2-dimethylpropylamino)propoxy]propan-2-yl]-2-methylpropane-1,2-diamine is CC(COCC(C)NCC(C)(C)N)NCC(C)(C)C.
What is the InChIKey of 1-N-[1-[2-(2,2-dimethylpropylamino)propoxy]propan-2-yl]-2-methylpropane-1,2-diamine?
The InChIKey is AHSUEKDSMSZQJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H35N3O/c1-12(17-10-14(3,4)5)8-19-9-13(2)18-11-15(6,7)16/h12-13,17-18H,8-11,16H2,1-7H3.
What are the key properties of 1-N-[1-[2-(2,2-dimethylpropylamino)propoxy]propan-2-yl]-2-methylpropane-1,2-diamine?
1-N-[1-[2-(2,2-dimethylpropylamino)propoxy]propan-2-yl]-2-methylpropane-1,2-diamine has a molecular weight of 273.46 g/mol, XLogP of 1.74, 9 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-[1-[2-(2,2-dimethylpropylamino)propoxy]propan-2-yl]-2-methylpropane-1,2-diamine is sourced from PubChem (CID 121460797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).