C21H20O4 — CID 121461091
(3E,5E)-3,5-bis[(2-methoxyphenyl)methylidene]oxan-4-one (PubChem CID 121461091) has the molecular formula C21H20O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is (3E,5E)-3,5-bis[(2-methoxyphenyl)methylidene]oxan-4-one.
| Compound Name | (3E,5E)-3,5-bis[(2-methoxyphenyl)methylidene]oxan-4-one |
|---|---|
| PubChem CID | 121461091 |
| Molecular Formula | C21H20O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | (3E,5E)-3,5-bis[(2-methoxyphenyl)methylidene]oxan-4-one |
| SMILES | COc1ccccc1/C=C1\COC/C(=C\c2ccccc2OC)C1=O |
| InChI | InChI=1S/C21H20O4/c1-23-19-9-5-3-7-15(19)11-17-13-25-14-18(21(17)22)12-16-8-4-6-10-20(16)24-2/h3-12H,13-14H2,1-2H3/b17-11+,18-12+ |
| InChIKey | QFCCHPDYYZFJAZ-JYFOCSDGSA-N |
| XLogP | 3.77 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|