C27H34O5 — CID 121461113
(2E,6E)-2-[(3E,5Z)-3,7-dimethoxy-2-methylidenehepta-3,5-dienylidene]-6-[(2,6-dimethoxyphenyl)methylidene]-4-ethylcyclohexan-1-one (PubChem CID 121461113) has the molecular formula C27H34O5 and a molecular weight of 438.56 g/mol. Its IUPAC name is (2E,6E)-2-[(3E,5Z)-3,7-dimethoxy-2-methylidenehepta-3,5-dienylidene]-6-[(2,6-dimethoxyphenyl)methylidene]-4-ethylcyclohexan-1-one.
| Compound Name | (2E,6E)-2-[(3E,5Z)-3,7-dimethoxy-2-methylidenehepta-3,5-dienylidene]-6-[(2,6-dimethoxyphenyl)methylidene]-4-ethylcyclohexan-1-one |
|---|---|
| PubChem CID | 121461113 |
| Molecular Formula | C27H34O5 |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | (2E,6E)-2-[(3E,5Z)-3,7-dimethoxy-2-methylidenehepta-3,5-dienylidene]-6-[(2,6-dimethoxyphenyl)methylidene]-4-ethylcyclohexan-1-one |
| SMILES | C=C(/C=C1\CC(CC)C/C(=C\c2c(OC)cccc2OC)C1=O)/C(=C\C=C/COC)OC |
| InChI | InChI=1S/C27H34O5/c1-7-20-16-21(15-19(2)24(30-4)11-8-9-14-29-3)27(28)22(17-20)18-23-25(31-5)12-10-13-26(23)32-6/h8-13,15,18,20H,2,7,14,16-17H2,1,3-6H3/b9-8-,21-15+,22-18+,24-11+ |
| InChIKey | DWVXXXIGUOINSR-JCHPUZPPSA-N |
| XLogP | 5.69 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|