About methyl 2-[[7-(4-cyanophenyl)-1,2-benzothiazol-6-yl]sulfanyl]-3-methylbutanoate
methyl 2-[[7-(4-cyanophenyl)-1,2-benzothiazol-6-yl]sulfanyl]-3-methylbutanoate (PubChem CID 121461371) has the molecular formula C20H18N2O2S2
and a molecular weight of 382.51 g/mol. Its IUPAC name is methyl 2-[[7-(4-cyanophenyl)-1,2-benzothiazol-6-yl]sulfanyl]-3-methylbutanoate.
Molecular Properties
| Compound Name | methyl 2-[[7-(4-cyanophenyl)-1,2-benzothiazol-6-yl]sulfanyl]-3-methylbutanoate |
| PubChem CID | 121461371 |
| Molecular Formula | C20H18N2O2S2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | methyl 2-[[7-(4-cyanophenyl)-1,2-benzothiazol-6-yl]sulfanyl]-3-methylbutanoate |
| SMILES | COC(=O)C(Sc1ccc2cnsc2c1-c1ccc(C#N)cc1)C(C)C |
| InChI | InChI=1S/C20H18N2O2S2/c1-12(2)18(20(23)24-3)25-16-9-8-15-11-22-26-19(15)17(16)14-6-4-13(10-21)5-7-14/h4-9,11-12,18H,1-3H3 |
| InChIKey | BHZKAJYXIOOFAZ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-[[7-(4-cyanophenyl)-1,2-benzothiazol-6-yl]sulfanyl]-3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[7-(4-cyanophenyl)-1,2-benzothiazol-6-yl]sulfanyl]-3-methylbutanoate?
The IUPAC name of methyl 2-[[7-(4-cyanophenyl)-1,2-benzothiazol-6-yl]sulfanyl]-3-methylbutanoate (CID 121461371) is methyl 2-[[7-(4-cyanophenyl)-1,2-benzothiazol-6-yl]sulfanyl]-3-methylbutanoate.
What is the SMILES notation for methyl 2-[[7-(4-cyanophenyl)-1,2-benzothiazol-6-yl]sulfanyl]-3-methylbutanoate?
The canonical SMILES for methyl 2-[[7-(4-cyanophenyl)-1,2-benzothiazol-6-yl]sulfanyl]-3-methylbutanoate is COC(=O)C(Sc1ccc2cnsc2c1-c1ccc(C#N)cc1)C(C)C.
What is the InChIKey of methyl 2-[[7-(4-cyanophenyl)-1,2-benzothiazol-6-yl]sulfanyl]-3-methylbutanoate?
The InChIKey is BHZKAJYXIOOFAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N2O2S2/c1-12(2)18(20(23)24-3)25-16-9-8-15-11-22-26-19(15)17(16)14-6-4-13(10-21)5-7-14/h4-9,11-12,18H,1-3H3.
What are the key properties of methyl 2-[[7-(4-cyanophenyl)-1,2-benzothiazol-6-yl]sulfanyl]-3-methylbutanoate?
methyl 2-[[7-(4-cyanophenyl)-1,2-benzothiazol-6-yl]sulfanyl]-3-methylbutanoate has a molecular weight of 382.51 g/mol, XLogP of 5.12, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[7-(4-cyanophenyl)-1,2-benzothiazol-6-yl]sulfanyl]-3-methylbutanoate is sourced from PubChem (CID 121461371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).