About 2-[[4-(4-cyanophenyl)-2,1,3-benzothiadiazol-5-yl]sulfanyl]-2-methylpropanoic acid
2-[[4-(4-cyanophenyl)-2,1,3-benzothiadiazol-5-yl]sulfanyl]-2-methylpropanoic acid (PubChem CID 121461419) has the molecular formula C17H13N3O2S2
and a molecular weight of 355.44 g/mol. Its IUPAC name is 2-[[4-(4-cyanophenyl)-2,1,3-benzothiadiazol-5-yl]sulfanyl]-2-methylpropanoic acid.
Molecular Properties
| Compound Name | 2-[[4-(4-cyanophenyl)-2,1,3-benzothiadiazol-5-yl]sulfanyl]-2-methylpropanoic acid |
| PubChem CID | 121461419 |
| Molecular Formula | C17H13N3O2S2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 2-[[4-(4-cyanophenyl)-2,1,3-benzothiadiazol-5-yl]sulfanyl]-2-methylpropanoic acid |
| SMILES | CC(C)(Sc1ccc2nsnc2c1-c1ccc(C#N)cc1)C(=O)O |
| InChI | InChI=1S/C17H13N3O2S2/c1-17(2,16(21)22)23-13-8-7-12-15(20-24-19-12)14(13)11-5-3-10(9-18)4-6-11/h3-8H,1-2H3,(H,21,22) |
| InChIKey | ZFTUJLAGWPBYNM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[4-(4-cyanophenyl)-2,1,3-benzothiadiazol-5-yl]sulfanyl]-2-methylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-(4-cyanophenyl)-2,1,3-benzothiadiazol-5-yl]sulfanyl]-2-methylpropanoic acid?
The IUPAC name of 2-[[4-(4-cyanophenyl)-2,1,3-benzothiadiazol-5-yl]sulfanyl]-2-methylpropanoic acid (CID 121461419) is 2-[[4-(4-cyanophenyl)-2,1,3-benzothiadiazol-5-yl]sulfanyl]-2-methylpropanoic acid.
What is the SMILES notation for 2-[[4-(4-cyanophenyl)-2,1,3-benzothiadiazol-5-yl]sulfanyl]-2-methylpropanoic acid?
The canonical SMILES for 2-[[4-(4-cyanophenyl)-2,1,3-benzothiadiazol-5-yl]sulfanyl]-2-methylpropanoic acid is CC(C)(Sc1ccc2nsnc2c1-c1ccc(C#N)cc1)C(=O)O.
What is the InChIKey of 2-[[4-(4-cyanophenyl)-2,1,3-benzothiadiazol-5-yl]sulfanyl]-2-methylpropanoic acid?
The InChIKey is ZFTUJLAGWPBYNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13N3O2S2/c1-17(2,16(21)22)23-13-8-7-12-15(20-24-19-12)14(13)11-5-3-10(9-18)4-6-11/h3-8H,1-2H3,(H,21,22).
What are the key properties of 2-[[4-(4-cyanophenyl)-2,1,3-benzothiadiazol-5-yl]sulfanyl]-2-methylpropanoic acid?
2-[[4-(4-cyanophenyl)-2,1,3-benzothiadiazol-5-yl]sulfanyl]-2-methylpropanoic acid has a molecular weight of 355.44 g/mol, XLogP of 4.19, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-(4-cyanophenyl)-2,1,3-benzothiadiazol-5-yl]sulfanyl]-2-methylpropanoic acid is sourced from PubChem (CID 121461419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).