C30H28F2N4O4S2 — CID 121461658
2-[5-(cyclopropylmethyl)-3-(4-fluoro-3-hex-1-ynylphenyl)-4-[(3-fluoro-4-sulfamoylphenyl)methyl]pyrazol-1-yl]-1,3-thiazole-4-carboxylic acid (PubChem CID 121461658) has the molecular formula C30H28F2N4O4S2 and a molecular weight of 610.71 g/mol. Its IUPAC name is 2-[5-(cyclopropylmethyl)-3-(4-fluoro-3-hex-1-ynylphenyl)-4-[(3-fluoro-4-sulfamoylphenyl)methyl]pyrazol-1-yl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[5-(cyclopropylmethyl)-3-(4-fluoro-3-hex-1-ynylphenyl)-4-[(3-fluoro-4-sulfamoylphenyl)methyl]pyrazol-1-yl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 121461658 |
| Molecular Formula | C30H28F2N4O4S2 |
| Molecular Weight | 610.71 g/mol |
| Exact Mass | 610.15 |
| IUPAC Name | 2-[5-(cyclopropylmethyl)-3-(4-fluoro-3-hex-1-ynylphenyl)-4-[(3-fluoro-4-sulfamoylphenyl)methyl]pyrazol-1-yl]-1,3-thiazole-4-carboxylic acid |
| SMILES | CCCCC#Cc1cc(-c2nn(-c3nc(C(=O)O)cs3)c(CC3CC3)c2Cc2ccc(S(N)(=O)=O)c(F)c2)ccc1F |
| InChI | InChI=1S/C30H28F2N4O4S2/c1-2-3-4-5-6-20-16-21(10-11-23(20)31)28-22(13-19-9-12-27(24(32)14-19)42(33,39)40)26(15-18-7-8-18)36(35-28)30-34-25(17-41-30)29(37)38/h9-12,14,16-18H,2-4,7-8,13,15H2,1H3,(H,37,38)(H2,33,39,40) |
| InChIKey | KCQRMZVWKDOQFN-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 128.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.71 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|