About [(1R,2S)-1-(2-fluoro-4-methylphenyl)-1-phenoxypropan-2-yl] (2S)-2-aminopropanoate
[(1R,2S)-1-(2-fluoro-4-methylphenyl)-1-phenoxypropan-2-yl] (2S)-2-aminopropanoate (PubChem CID 121462231) has the molecular formula C19H22FNO3
and a molecular weight of 331.39 g/mol. Its IUPAC name is [(1R,2S)-1-(2-fluoro-4-methylphenyl)-1-phenoxypropan-2-yl] (2S)-2-aminopropanoate.
Molecular Properties
| Compound Name | [(1R,2S)-1-(2-fluoro-4-methylphenyl)-1-phenoxypropan-2-yl] (2S)-2-aminopropanoate |
| PubChem CID | 121462231 |
| Molecular Formula | C19H22FNO3 |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | [(1R,2S)-1-(2-fluoro-4-methylphenyl)-1-phenoxypropan-2-yl] (2S)-2-aminopropanoate |
| SMILES | Cc1ccc([C@@H](Oc2ccccc2)[C@H](C)OC(=O)[C@H](C)N)c(F)c1 |
| InChI | InChI=1S/C19H22FNO3/c1-12-9-10-16(17(20)11-12)18(14(3)23-19(22)13(2)21)24-15-7-5-4-6-8-15/h4-11,13-14,18H,21H2,1-3H3/t13-,14-,18-/m0/s1 |
| InChIKey | VMONUGGPDLPSPF-DEYYWGMASA-N |
| XLogP | 3.53 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(1R,2S)-1-(2-fluoro-4-methylphenyl)-1-phenoxypropan-2-yl] (2S)-2-aminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2S)-1-(2-fluoro-4-methylphenyl)-1-phenoxypropan-2-yl] (2S)-2-aminopropanoate?
The IUPAC name of [(1R,2S)-1-(2-fluoro-4-methylphenyl)-1-phenoxypropan-2-yl] (2S)-2-aminopropanoate (CID 121462231) is [(1R,2S)-1-(2-fluoro-4-methylphenyl)-1-phenoxypropan-2-yl] (2S)-2-aminopropanoate.
What is the SMILES notation for [(1R,2S)-1-(2-fluoro-4-methylphenyl)-1-phenoxypropan-2-yl] (2S)-2-aminopropanoate?
The canonical SMILES for [(1R,2S)-1-(2-fluoro-4-methylphenyl)-1-phenoxypropan-2-yl] (2S)-2-aminopropanoate is Cc1ccc([C@@H](Oc2ccccc2)[C@H](C)OC(=O)[C@H](C)N)c(F)c1.
What is the InChIKey of [(1R,2S)-1-(2-fluoro-4-methylphenyl)-1-phenoxypropan-2-yl] (2S)-2-aminopropanoate?
The InChIKey is VMONUGGPDLPSPF-DEYYWGMASA-N. The full InChI is InChI=1S/C19H22FNO3/c1-12-9-10-16(17(20)11-12)18(14(3)23-19(22)13(2)21)24-15-7-5-4-6-8-15/h4-11,13-14,18H,21H2,1-3H3/t13-,14-,18-/m0/s1.
What are the key properties of [(1R,2S)-1-(2-fluoro-4-methylphenyl)-1-phenoxypropan-2-yl] (2S)-2-aminopropanoate?
[(1R,2S)-1-(2-fluoro-4-methylphenyl)-1-phenoxypropan-2-yl] (2S)-2-aminopropanoate has a molecular weight of 331.39 g/mol, XLogP of 3.53, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2S)-1-(2-fluoro-4-methylphenyl)-1-phenoxypropan-2-yl] (2S)-2-aminopropanoate is sourced from PubChem (CID 121462231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).