About (1-chloro-5,6,7,8-tetrahydroisoquinolin-4-yl)methanimine
(1-chloro-5,6,7,8-tetrahydroisoquinolin-4-yl)methanimine (PubChem CID 121463135) has the molecular formula C10H11ClN2
and a molecular weight of 194.67 g/mol. Its IUPAC name is (1-chloro-5,6,7,8-tetrahydroisoquinolin-4-yl)methanimine.
Molecular Properties
| Compound Name | (1-chloro-5,6,7,8-tetrahydroisoquinolin-4-yl)methanimine |
| PubChem CID | 121463135 |
| Molecular Formula | C10H11ClN2 |
| Molecular Weight | 194.67 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | (1-chloro-5,6,7,8-tetrahydroisoquinolin-4-yl)methanimine |
| SMILES | [H]/N=C/c1cnc(Cl)c2c1CCCC2 |
| InChI | InChI=1S/C10H11ClN2/c11-10-9-4-2-1-3-8(9)7(5-12)6-13-10/h5-6,12H,1-4H2/b12-5+ |
| InChIKey | JHICTURYECYEFJ-LFYBBSHMSA-N |
| XLogP | 2.61 |
| TPSA | 36.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.67 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (1-chloro-5,6,7,8-tetrahydroisoquinolin-4-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-chloro-5,6,7,8-tetrahydroisoquinolin-4-yl)methanimine?
The IUPAC name of (1-chloro-5,6,7,8-tetrahydroisoquinolin-4-yl)methanimine (CID 121463135) is (1-chloro-5,6,7,8-tetrahydroisoquinolin-4-yl)methanimine.
What is the SMILES notation for (1-chloro-5,6,7,8-tetrahydroisoquinolin-4-yl)methanimine?
The canonical SMILES for (1-chloro-5,6,7,8-tetrahydroisoquinolin-4-yl)methanimine is [H]/N=C/c1cnc(Cl)c2c1CCCC2.
What is the InChIKey of (1-chloro-5,6,7,8-tetrahydroisoquinolin-4-yl)methanimine?
The InChIKey is JHICTURYECYEFJ-LFYBBSHMSA-N. The full InChI is InChI=1S/C10H11ClN2/c11-10-9-4-2-1-3-8(9)7(5-12)6-13-10/h5-6,12H,1-4H2/b12-5+.
What are the key properties of (1-chloro-5,6,7,8-tetrahydroisoquinolin-4-yl)methanimine?
(1-chloro-5,6,7,8-tetrahydroisoquinolin-4-yl)methanimine has a molecular weight of 194.67 g/mol, XLogP of 2.61, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-chloro-5,6,7,8-tetrahydroisoquinolin-4-yl)methanimine is sourced from PubChem (CID 121463135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).