C12H14F2 — CID 121463171
3,4-difluoro-2,3,5-trimethyl-1,2-dihydroindene (PubChem CID 121463171) has the molecular formula C12H14F2 and a molecular weight of 196.24 g/mol. Its IUPAC name is 3,4-difluoro-2,3,5-trimethyl-1,2-dihydroindene.
| Compound Name | 3,4-difluoro-2,3,5-trimethyl-1,2-dihydroindene |
|---|---|
| PubChem CID | 121463171 |
| Molecular Formula | C12H14F2 |
| Molecular Weight | 196.24 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 3,4-difluoro-2,3,5-trimethyl-1,2-dihydroindene |
| SMILES | Cc1ccc2c(c1F)C(C)(F)C(C)C2 |
| InChI | InChI=1S/C12H14F2/c1-7-4-5-9-6-8(2)12(3,14)10(9)11(7)13/h4-5,8H,6H2,1-3H3 |
| InChIKey | WXWVWUHJLYQESF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.24 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |