C15H9F6N4O3S- — CID 121463266
2-[3-methyl-6-(2,2,2-trifluoroethoxy)imidazo[4,5-c]pyridin-2-yl]-5-(trifluoromethyl)pyridine-3-sulfinate (PubChem CID 121463266) has the molecular formula C15H9F6N4O3S- and a molecular weight of 439.32 g/mol. Its IUPAC name is 2-[3-methyl-6-(2,2,2-trifluoroethoxy)imidazo[4,5-c]pyridin-2-yl]-5-(trifluoromethyl)pyridine-3-sulfinate.
| Compound Name | 2-[3-methyl-6-(2,2,2-trifluoroethoxy)imidazo[4,5-c]pyridin-2-yl]-5-(trifluoromethyl)pyridine-3-sulfinate |
|---|---|
| PubChem CID | 121463266 |
| Molecular Formula | C15H9F6N4O3S- |
| Molecular Weight | 439.32 g/mol |
| Exact Mass | 439.03 |
| IUPAC Name | 2-[3-methyl-6-(2,2,2-trifluoroethoxy)imidazo[4,5-c]pyridin-2-yl]-5-(trifluoromethyl)pyridine-3-sulfinate |
| SMILES | Cn1c(-c2ncc(C(F)(F)F)cc2S(=O)[O-])nc2cc(OCC(F)(F)F)ncc21 |
| InChI | InChI=1S/C15H10F6N4O3S/c1-25-9-5-22-11(28-6-14(16,17)18)3-8(9)24-13(25)12-10(29(26)27)2-7(4-23-12)15(19,20)21/h2-5H,6H2,1H3,(H,26,27)/p-1 |
| InChIKey | CNENCPYNYGTKSI-UHFFFAOYSA-M |
| XLogP | 3.23 |
| TPSA | 92.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.32 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|