C20H25NO2 — CID 121463848
[(2S)-1,1-bis(4-methylphenyl)propan-2-yl] (2S)-2-aminopropanoate (PubChem CID 121463848) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is [(2S)-1,1-bis(4-methylphenyl)propan-2-yl] (2S)-2-aminopropanoate.
| Compound Name | [(2S)-1,1-bis(4-methylphenyl)propan-2-yl] (2S)-2-aminopropanoate |
|---|---|
| PubChem CID | 121463848 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | [(2S)-1,1-bis(4-methylphenyl)propan-2-yl] (2S)-2-aminopropanoate |
| SMILES | Cc1ccc(C(c2ccc(C)cc2)[C@H](C)OC(=O)[C@H](C)N)cc1 |
| InChI | InChI=1S/C20H25NO2/c1-13-5-9-17(10-6-13)19(16(4)23-20(22)15(3)21)18-11-7-14(2)8-12-18/h5-12,15-16,19H,21H2,1-4H3/t15-,16-/m0/s1 |
| InChIKey | LGDIQZUYQWQOJE-HOTGVXAUSA-N |
| XLogP | 3.71 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |