About (E)-3-methyl-N-[(2Z)-2-(methylideneamino)penta-2,4-dienyl]hex-2-enamide
(E)-3-methyl-N-[(2Z)-2-(methylideneamino)penta-2,4-dienyl]hex-2-enamide (PubChem CID 121464236) has the molecular formula C13H20N2O
and a molecular weight of 220.32 g/mol. Its IUPAC name is (E)-3-methyl-N-[(2Z)-2-(methylideneamino)penta-2,4-dienyl]hex-2-enamide.
Molecular Properties
| Compound Name | (E)-3-methyl-N-[(2Z)-2-(methylideneamino)penta-2,4-dienyl]hex-2-enamide |
| PubChem CID | 121464236 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | (E)-3-methyl-N-[(2Z)-2-(methylideneamino)penta-2,4-dienyl]hex-2-enamide |
| SMILES | C=C/C=C(/CNC(=O)/C=C(\C)CCC)N=C |
| InChI | InChI=1S/C13H20N2O/c1-5-7-11(3)9-13(16)15-10-12(14-4)8-6-2/h6,8-9H,2,4-5,7,10H2,1,3H3,(H,15,16)/b11-9+,12-8- |
| InChIKey | HSVSGXCLKYJRTG-JTTDQXDJSA-N |
| XLogP | 2.62 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-methyl-N-[(2Z)-2-(methylideneamino)penta-2,4-dienyl]hex-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-methyl-N-[(2Z)-2-(methylideneamino)penta-2,4-dienyl]hex-2-enamide?
The IUPAC name of (E)-3-methyl-N-[(2Z)-2-(methylideneamino)penta-2,4-dienyl]hex-2-enamide (CID 121464236) is (E)-3-methyl-N-[(2Z)-2-(methylideneamino)penta-2,4-dienyl]hex-2-enamide.
What is the SMILES notation for (E)-3-methyl-N-[(2Z)-2-(methylideneamino)penta-2,4-dienyl]hex-2-enamide?
The canonical SMILES for (E)-3-methyl-N-[(2Z)-2-(methylideneamino)penta-2,4-dienyl]hex-2-enamide is C=C/C=C(/CNC(=O)/C=C(\C)CCC)N=C.
What is the InChIKey of (E)-3-methyl-N-[(2Z)-2-(methylideneamino)penta-2,4-dienyl]hex-2-enamide?
The InChIKey is HSVSGXCLKYJRTG-JTTDQXDJSA-N. The full InChI is InChI=1S/C13H20N2O/c1-5-7-11(3)9-13(16)15-10-12(14-4)8-6-2/h6,8-9H,2,4-5,7,10H2,1,3H3,(H,15,16)/b11-9+,12-8-.
What are the key properties of (E)-3-methyl-N-[(2Z)-2-(methylideneamino)penta-2,4-dienyl]hex-2-enamide?
(E)-3-methyl-N-[(2Z)-2-(methylideneamino)penta-2,4-dienyl]hex-2-enamide has a molecular weight of 220.32 g/mol, XLogP of 2.62, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-methyl-N-[(2Z)-2-(methylideneamino)penta-2,4-dienyl]hex-2-enamide is sourced from PubChem (CID 121464236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).