C11H17F3O — CID 121464247
(3E)-4-methyl-2-(2,2,2-trifluoroethoxy)octa-1,3-diene (PubChem CID 121464247) has the molecular formula C11H17F3O and a molecular weight of 222.25 g/mol. Its IUPAC name is (3E)-4-methyl-2-(2,2,2-trifluoroethoxy)octa-1,3-diene.
| Compound Name | (3E)-4-methyl-2-(2,2,2-trifluoroethoxy)octa-1,3-diene |
|---|---|
| PubChem CID | 121464247 |
| Molecular Formula | C11H17F3O |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | (3E)-4-methyl-2-(2,2,2-trifluoroethoxy)octa-1,3-diene |
| SMILES | C=C(/C=C(\C)CCCC)OCC(F)(F)F |
| InChI | InChI=1S/C11H17F3O/c1-4-5-6-9(2)7-10(3)15-8-11(12,13)14/h7H,3-6,8H2,1-2H3/b9-7+ |
| InChIKey | QCZSMJWPMWISAX-VQHVLOKHSA-N |
| XLogP | 4.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|