About 5-O-[2-(dimethylamino)ethyl] 1-O-(2-methoxyethyl) 2,2,4-trimethylpentanedioate
5-O-[2-(dimethylamino)ethyl] 1-O-(2-methoxyethyl) 2,2,4-trimethylpentanedioate (PubChem CID 121464511) has the molecular formula C15H29NO5
and a molecular weight of 303.40 g/mol. Its IUPAC name is 5-O-[2-(dimethylamino)ethyl] 1-O-(2-methoxyethyl) 2,2,4-trimethylpentanedioate.
Molecular Properties
| Compound Name | 5-O-[2-(dimethylamino)ethyl] 1-O-(2-methoxyethyl) 2,2,4-trimethylpentanedioate |
| PubChem CID | 121464511 |
| Molecular Formula | C15H29NO5 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | 5-O-[2-(dimethylamino)ethyl] 1-O-(2-methoxyethyl) 2,2,4-trimethylpentanedioate |
| SMILES | COCCOC(=O)C(C)(C)CC(C)C(=O)OCCN(C)C |
| InChI | InChI=1S/C15H29NO5/c1-12(13(17)20-8-7-16(4)5)11-15(2,3)14(18)21-10-9-19-6/h12H,7-11H2,1-6H3 |
| InChIKey | FFDNHDDBEKGYDL-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-O-[2-(dimethylamino)ethyl] 1-O-(2-methoxyethyl) 2,2,4-trimethylpentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-O-[2-(dimethylamino)ethyl] 1-O-(2-methoxyethyl) 2,2,4-trimethylpentanedioate?
The IUPAC name of 5-O-[2-(dimethylamino)ethyl] 1-O-(2-methoxyethyl) 2,2,4-trimethylpentanedioate (CID 121464511) is 5-O-[2-(dimethylamino)ethyl] 1-O-(2-methoxyethyl) 2,2,4-trimethylpentanedioate.
What is the SMILES notation for 5-O-[2-(dimethylamino)ethyl] 1-O-(2-methoxyethyl) 2,2,4-trimethylpentanedioate?
The canonical SMILES for 5-O-[2-(dimethylamino)ethyl] 1-O-(2-methoxyethyl) 2,2,4-trimethylpentanedioate is COCCOC(=O)C(C)(C)CC(C)C(=O)OCCN(C)C.
What is the InChIKey of 5-O-[2-(dimethylamino)ethyl] 1-O-(2-methoxyethyl) 2,2,4-trimethylpentanedioate?
The InChIKey is FFDNHDDBEKGYDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29NO5/c1-12(13(17)20-8-7-16(4)5)11-15(2,3)14(18)21-10-9-19-6/h12H,7-11H2,1-6H3.
What are the key properties of 5-O-[2-(dimethylamino)ethyl] 1-O-(2-methoxyethyl) 2,2,4-trimethylpentanedioate?
5-O-[2-(dimethylamino)ethyl] 1-O-(2-methoxyethyl) 2,2,4-trimethylpentanedioate has a molecular weight of 303.40 g/mol, XLogP of 1.33, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-O-[2-(dimethylamino)ethyl] 1-O-(2-methoxyethyl) 2,2,4-trimethylpentanedioate is sourced from PubChem (CID 121464511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).