C23H32N4O3S — CID 121464582
tert-butyl N-methyl-N-[4-[[(3R)-3-(2-oxoethyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl]amino]cyclohexyl]carbamate (PubChem CID 121464582) has the molecular formula C23H32N4O3S and a molecular weight of 444.60 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[4-[[(3R)-3-(2-oxoethyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl]amino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[4-[[(3R)-3-(2-oxoethyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl]amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 121464582 |
| Molecular Formula | C23H32N4O3S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | tert-butyl N-methyl-N-[4-[[(3R)-3-(2-oxoethyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl]amino]cyclohexyl]carbamate |
| SMILES | CN(C(=O)OC(C)(C)C)C1CCC(Nc2ncnc3sc4c(c23)[C@@H](CC=O)CC4)CC1 |
| InChI | InChI=1S/C23H32N4O3S/c1-23(2,3)30-22(29)27(4)16-8-6-15(7-9-16)26-20-19-18-14(11-12-28)5-10-17(18)31-21(19)25-13-24-20/h12-16H,5-11H2,1-4H3,(H,24,25,26)/t14-,15?,16?/m1/s1 |
| InChIKey | FSIVFGPTZXLKPC-QQFBHYJXSA-N |
| XLogP | 4.90 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|