C30H31F2N5O2 — CID 121464653
(6R,8aS)-6-[8-amino-1-[4-[(1R)-1-[3-(1,1-difluoroethyl)phenyl]-1-hydroxyethyl]phenyl]imidazo[1,5-a]pyrazin-3-yl]-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one (PubChem CID 121464653) has the molecular formula C30H31F2N5O2 and a molecular weight of 531.61 g/mol. Its IUPAC name is (6R,8aS)-6-[8-amino-1-[4-[(1R)-1-[3-(1,1-difluoroethyl)phenyl]-1-hydroxyethyl]phenyl]imidazo[1,5-a]pyrazin-3-yl]-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one.
| Compound Name | (6R,8aS)-6-[8-amino-1-[4-[(1R)-1-[3-(1,1-difluoroethyl)phenyl]-1-hydroxyethyl]phenyl]imidazo[1,5-a]pyrazin-3-yl]-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
|---|---|
| PubChem CID | 121464653 |
| Molecular Formula | C30H31F2N5O2 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.24 |
| IUPAC Name | (6R,8aS)-6-[8-amino-1-[4-[(1R)-1-[3-(1,1-difluoroethyl)phenyl]-1-hydroxyethyl]phenyl]imidazo[1,5-a]pyrazin-3-yl]-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
| SMILES | CC(F)(F)c1cccc([C@](C)(O)c2ccc(-c3nc([C@@H]4CC[C@H]5CCC(=O)N5C4)n4ccnc(N)c34)cc2)c1 |
| InChI | InChI=1S/C30H31F2N5O2/c1-29(39,21-4-3-5-22(16-21)30(2,31)32)20-9-6-18(7-10-20)25-26-27(33)34-14-15-36(26)28(35-25)19-8-11-23-12-13-24(38)37(23)17-19/h3-7,9-10,14-16,19,23,39H,8,11-13,17H2,1-2H3,(H2,33,34)/t19-,23+,29-/m1/s1 |
| InChIKey | NIEWAGFRRQZKOH-KBXCTZIRSA-N |
| XLogP | 5.21 |
| TPSA | 96.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |