C29H28F3N5O2 — CID 121464670
(6R,8aS)-6-[8-amino-1-[4-[(1R)-1-[3-(difluoromethyl)phenyl]-1-hydroxyethyl]phenyl]-5-fluoroimidazo[1,5-a]pyrazin-3-yl]-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one (PubChem CID 121464670) has the molecular formula C29H28F3N5O2 and a molecular weight of 535.57 g/mol. Its IUPAC name is (6R,8aS)-6-[8-amino-1-[4-[(1R)-1-[3-(difluoromethyl)phenyl]-1-hydroxyethyl]phenyl]-5-fluoroimidazo[1,5-a]pyrazin-3-yl]-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one.
| Compound Name | (6R,8aS)-6-[8-amino-1-[4-[(1R)-1-[3-(difluoromethyl)phenyl]-1-hydroxyethyl]phenyl]-5-fluoroimidazo[1,5-a]pyrazin-3-yl]-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
|---|---|
| PubChem CID | 121464670 |
| Molecular Formula | C29H28F3N5O2 |
| Molecular Weight | 535.57 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | (6R,8aS)-6-[8-amino-1-[4-[(1R)-1-[3-(difluoromethyl)phenyl]-1-hydroxyethyl]phenyl]-5-fluoroimidazo[1,5-a]pyrazin-3-yl]-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
| SMILES | C[C@@](O)(c1ccc(-c2nc([C@@H]3CC[C@H]4CCC(=O)N4C3)n3c(F)cnc(N)c23)cc1)c1cccc(C(F)F)c1 |
| InChI | InChI=1S/C29H28F3N5O2/c1-29(39,20-4-2-3-17(13-20)26(31)32)19-8-5-16(6-9-19)24-25-27(33)34-14-22(30)37(25)28(35-24)18-7-10-21-11-12-23(38)36(21)15-18/h2-6,8-9,13-14,18,21,26,39H,7,10-12,15H2,1H3,(H2,33,34)/t18-,21+,29-/m1/s1 |
| InChIKey | PWDWKKXUAJBSBY-OVPJMRJESA-N |
| XLogP | 5.18 |
| TPSA | 96.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.57 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |