C32H37N5O2 — CID 121464686
(6R,8aS)-6-[8-amino-1-[4-[(1R)-1-(3-tert-butylphenyl)-1-hydroxyethyl]phenyl]imidazo[1,5-a]pyrazin-3-yl]-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one (PubChem CID 121464686) has the molecular formula C32H37N5O2 and a molecular weight of 523.68 g/mol. Its IUPAC name is (6R,8aS)-6-[8-amino-1-[4-[(1R)-1-(3-tert-butylphenyl)-1-hydroxyethyl]phenyl]imidazo[1,5-a]pyrazin-3-yl]-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one.
| Compound Name | (6R,8aS)-6-[8-amino-1-[4-[(1R)-1-(3-tert-butylphenyl)-1-hydroxyethyl]phenyl]imidazo[1,5-a]pyrazin-3-yl]-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
|---|---|
| PubChem CID | 121464686 |
| Molecular Formula | C32H37N5O2 |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.29 |
| IUPAC Name | (6R,8aS)-6-[8-amino-1-[4-[(1R)-1-(3-tert-butylphenyl)-1-hydroxyethyl]phenyl]imidazo[1,5-a]pyrazin-3-yl]-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
| SMILES | CC(C)(C)c1cccc([C@](C)(O)c2ccc(-c3nc([C@@H]4CC[C@H]5CCC(=O)N5C4)n4ccnc(N)c34)cc2)c1 |
| InChI | InChI=1S/C32H37N5O2/c1-31(2,3)23-6-5-7-24(18-23)32(4,39)22-11-8-20(9-12-22)27-28-29(33)34-16-17-36(28)30(35-27)21-10-13-25-14-15-26(38)37(25)19-21/h5-9,11-12,16-18,21,25,39H,10,13-15,19H2,1-4H3,(H2,33,34)/t21-,25+,32-/m1/s1 |
| InChIKey | QTZDEWNUIJQSNC-QDFWLLCMSA-N |
| XLogP | 5.40 |
| TPSA | 96.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |